C29H30FN3O5 — CID 143528380
N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(3-hydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 143528380) has the molecular formula C29H30FN3O5 and a molecular weight of 519.57 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(3-hydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(3-hydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 143528380 |
| Molecular Formula | C29H30FN3O5 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(3-hydroxypropoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | Cc1ccc(NC(=O)C(C(C)c2ccccc2)N2C(=O)N[C@H](c3ccc(OCCCO)cc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C29H30FN3O5/c1-18-9-14-24(23(30)17-18)31-27(35)26(19(2)20-7-4-3-5-8-20)33-28(36)25(32-29(33)37)21-10-12-22(13-11-21)38-16-6-15-34/h3-5,7-14,17,19,25-26,34H,6,15-16H2,1-2H3,(H,31,35)(H,32,37)/t19?,25-,26?/m1/s1 |
| InChIKey | SOVWGBRDNMJUOI-MMTWIKPJSA-N |
| XLogP | 4.30 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|