C28H26FIN4O5 — CID 140518952
N-(2-fluoro-4-iodophenyl)-2-[(4R)-4-[4-[2-(methylamino)-2-oxoethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 140518952) has the molecular formula C28H26FIN4O5 and a molecular weight of 644.44 g/mol. Its IUPAC name is N-(2-fluoro-4-iodophenyl)-2-[(4R)-4-[4-[2-(methylamino)-2-oxoethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | N-(2-fluoro-4-iodophenyl)-2-[(4R)-4-[4-[2-(methylamino)-2-oxoethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 140518952 |
| Molecular Formula | C28H26FIN4O5 |
| Molecular Weight | 644.44 g/mol |
| Exact Mass | 644.09 |
| IUPAC Name | N-(2-fluoro-4-iodophenyl)-2-[(4R)-4-[4-[2-(methylamino)-2-oxoethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | CNC(=O)COc1ccc([C@H]2NC(=O)N(C(C(=O)Nc3ccc(I)cc3F)C(C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26FIN4O5/c1-16(17-6-4-3-5-7-17)25(26(36)32-22-13-10-19(30)14-21(22)29)34-27(37)24(33-28(34)38)18-8-11-20(12-9-18)39-15-23(35)31-2/h3-14,16,24-25H,15H2,1-2H3,(H,31,35)(H,32,36)(H,33,38)/t16?,24-,25?/m1/s1 |
| InChIKey | CADFNERKDNMSNA-ZJDFVGHUSA-N |
| XLogP | 3.96 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|