C28H28IN3O5 — CID 71080775
(3S)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(4-iodo-2-methylphenyl)-3-phenylbutanamide (PubChem CID 71080775) has the molecular formula C28H28IN3O5 and a molecular weight of 613.45 g/mol. Its IUPAC name is (3S)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(4-iodo-2-methylphenyl)-3-phenylbutanamide.
| Compound Name | (3S)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(4-iodo-2-methylphenyl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 71080775 |
| Molecular Formula | C28H28IN3O5 |
| Molecular Weight | 613.45 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | (3S)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-N-(4-iodo-2-methylphenyl)-3-phenylbutanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C([C@@H](C)c1ccccc1)N1C(=O)N[C@H](c2ccc(OCCO)cc2)C1=O |
| InChI | InChI=1S/C28H28IN3O5/c1-17-16-21(29)10-13-23(17)30-26(34)25(18(2)19-6-4-3-5-7-19)32-27(35)24(31-28(32)36)20-8-11-22(12-9-20)37-15-14-33/h3-13,16,18,24-25,33H,14-15H2,1-2H3,(H,30,34)(H,31,36)/t18-,24+,25?/m0/s1 |
| InChIKey | MQWKIMJYRQUMFC-HKNRPGJNSA-N |
| XLogP | 4.37 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|