C32H38FN3O6 — CID 143528401
ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 143528401) has the molecular formula C32H38FN3O6 and a molecular weight of 579.67 g/mol. Its IUPAC name is ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 143528401 |
| Molecular Formula | C32H38FN3O6 |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | CC.Cc1ccc(NC(=O)C(C(C)c2ccccc2)N2C(=O)N[C@H](c3ccc(OCCOCCO)cc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C30H32FN3O6.C2H6/c1-19-8-13-25(24(31)18-19)32-28(36)27(20(2)21-6-4-3-5-7-21)34-29(37)26(33-30(34)38)22-9-11-23(12-10-22)40-17-16-39-15-14-35;1-2/h3-13,18,20,26-27,35H,14-17H2,1-2H3,(H,32,36)(H,33,38);1-2H3/t20?,26-,27?;/m1./s1 |
| InChIKey | UUUXLDSWDRDRHS-ZHKIQSBESA-N |
| XLogP | 4.95 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|