C30H34FN3O5 — CID 143528349
ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4-phenylbutanamide (PubChem CID 143528349) has the molecular formula C30H34FN3O5 and a molecular weight of 535.62 g/mol. Its IUPAC name is ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4-phenylbutanamide.
| Compound Name | ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 143528349 |
| Molecular Formula | C30H34FN3O5 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | ethane;N-(2-fluoro-4-methylphenyl)-2-[(4R)-4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-4-phenylbutanamide |
| SMILES | CC.Cc1ccc(NC(=O)C(CCc2ccccc2)N2C(=O)N[C@H](c3ccc(OCCO)cc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C28H28FN3O5.C2H6/c1-18-7-13-23(22(29)17-18)30-26(34)24(14-8-19-5-3-2-4-6-19)32-27(35)25(31-28(32)36)20-9-11-21(12-10-20)37-16-15-33;1-2/h2-7,9-13,17,24-25,33H,8,14-16H2,1H3,(H,30,34)(H,31,36);1-2H3/t24?,25-;/m1./s1 |
| InChIKey | CERCPVICMJOUMY-HYSHBGFUSA-N |
| XLogP | 4.76 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|