C23H23FIN3O5 — CID 68618919
3-cyclopropyl-N-(2-fluoro-4-iodophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 68618919) has the molecular formula C23H23FIN3O5 and a molecular weight of 567.36 g/mol. Its IUPAC name is 3-cyclopropyl-N-(2-fluoro-4-iodophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | 3-cyclopropyl-N-(2-fluoro-4-iodophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 68618919 |
| Molecular Formula | C23H23FIN3O5 |
| Molecular Weight | 567.36 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 3-cyclopropyl-N-(2-fluoro-4-iodophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | O=C(Nc1ccc(I)cc1F)C(CC1CC1)N1C(=O)NC(c2ccc(OCCO)cc2)C1=O |
| InChI | InChI=1S/C23H23FIN3O5/c24-17-12-15(25)5-8-18(17)26-21(30)19(11-13-1-2-13)28-22(31)20(27-23(28)32)14-3-6-16(7-4-14)33-10-9-29/h3-8,12-13,19-20,29H,1-2,9-11H2,(H,26,30)(H,27,32) |
| InChIKey | XCPINEIHLQIOPZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|