C26H23FIN3O5 — CID 71080704
N-(2-fluoro-4-iodophenyl)-3-(2-methoxyphenyl)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 71080704) has the molecular formula C26H23FIN3O5 and a molecular weight of 603.39 g/mol. Its IUPAC name is N-(2-fluoro-4-iodophenyl)-3-(2-methoxyphenyl)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluoro-4-iodophenyl)-3-(2-methoxyphenyl)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 71080704 |
| Molecular Formula | C26H23FIN3O5 |
| Molecular Weight | 603.39 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | N-(2-fluoro-4-iodophenyl)-3-(2-methoxyphenyl)-2-[(4R)-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | COc1ccc([C@H]2NC(=O)N(C(Cc3ccccc3OC)C(=O)Nc3ccc(I)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C26H23FIN3O5/c1-35-18-10-7-15(8-11-18)23-25(33)31(26(34)30-23)21(13-16-5-3-4-6-22(16)36-2)24(32)29-20-12-9-17(28)14-19(20)27/h3-12,14,21,23H,13H2,1-2H3,(H,29,32)(H,30,34)/t21?,23-/m1/s1 |
| InChIKey | IJLHKKPMLFXKJI-JFGZAKSSSA-N |
| XLogP | 4.29 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|