C26H24FIN3O7P — CID 68618483
[4-[(4R)-1-[(2S,3R)-1-(2-fluoro-4-iodoanilino)-1-oxo-3-phenylbutan-2-yl]-2,5-dioxoimidazolidin-4-yl]phenoxy]methylphosphonic acid (PubChem CID 68618483) has the molecular formula C26H24FIN3O7P and a molecular weight of 667.37 g/mol. Its IUPAC name is [4-[(4R)-1-[(2S,3R)-1-(2-fluoro-4-iodoanilino)-1-oxo-3-phenylbutan-2-yl]-2,5-dioxoimidazolidin-4-yl]phenoxy]methylphosphonic acid.
| Compound Name | [4-[(4R)-1-[(2S,3R)-1-(2-fluoro-4-iodoanilino)-1-oxo-3-phenylbutan-2-yl]-2,5-dioxoimidazolidin-4-yl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 68618483 |
| Molecular Formula | C26H24FIN3O7P |
| Molecular Weight | 667.37 g/mol |
| Exact Mass | 667.04 |
| IUPAC Name | [4-[(4R)-1-[(2S,3R)-1-(2-fluoro-4-iodoanilino)-1-oxo-3-phenylbutan-2-yl]-2,5-dioxoimidazolidin-4-yl]phenoxy]methylphosphonic acid |
| SMILES | C[C@H](c1ccccc1)[C@@H](C(=O)Nc1ccc(I)cc1F)N1C(=O)N[C@H](c2ccc(OCP(=O)(O)O)cc2)C1=O |
| InChI | InChI=1S/C26H24FIN3O7P/c1-15(16-5-3-2-4-6-16)23(24(32)29-21-12-9-18(28)13-20(21)27)31-25(33)22(30-26(31)34)17-7-10-19(11-8-17)38-14-39(35,36)37/h2-13,15,22-23H,14H2,1H3,(H,29,32)(H,30,34)(H2,35,36,37)/t15-,22-,23+/m1/s1 |
| InChIKey | CCZNJGUTNVKZJQ-IEKZBVHVSA-N |
| XLogP | 4.35 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|