C29H26FN3O5 — CID 87654596
(2R,3S)-N-(4-ethynyl-2-fluorophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 87654596) has the molecular formula C29H26FN3O5 and a molecular weight of 515.54 g/mol. Its IUPAC name is (2R,3S)-N-(4-ethynyl-2-fluorophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | (2R,3S)-N-(4-ethynyl-2-fluorophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 87654596 |
| Molecular Formula | C29H26FN3O5 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | (2R,3S)-N-(4-ethynyl-2-fluorophenyl)-2-[4-[4-(2-hydroxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | C#Cc1ccc(NC(=O)[C@@H]([C@@H](C)c2ccccc2)N2C(=O)NC(c3ccc(OCCO)cc3)C2=O)c(F)c1 |
| InChI | InChI=1S/C29H26FN3O5/c1-3-19-9-14-24(23(30)17-19)31-27(35)26(18(2)20-7-5-4-6-8-20)33-28(36)25(32-29(33)37)21-10-12-22(13-11-21)38-16-15-34/h1,4-14,17-18,25-26,34H,15-16H2,2H3,(H,31,35)(H,32,37)/t18-,25?,26+/m0/s1 |
| InChIKey | VRBFVINTLVEXRR-HMXHBYFJSA-N |
| XLogP | 3.58 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|