C26H30FIN4O5 — CID 68620558
N-(2-fluoro-4-iodophenyl)-3-methyl-2-[4-[4-(2-morpholin-4-ylethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]butanamide (PubChem CID 68620558) has the molecular formula C26H30FIN4O5 and a molecular weight of 624.45 g/mol. Its IUPAC name is N-(2-fluoro-4-iodophenyl)-3-methyl-2-[4-[4-(2-morpholin-4-ylethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]butanamide.
| Compound Name | N-(2-fluoro-4-iodophenyl)-3-methyl-2-[4-[4-(2-morpholin-4-ylethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 68620558 |
| Molecular Formula | C26H30FIN4O5 |
| Molecular Weight | 624.45 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | N-(2-fluoro-4-iodophenyl)-3-methyl-2-[4-[4-(2-morpholin-4-ylethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]butanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(I)cc1F)N1C(=O)NC(c2ccc(OCCN3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C26H30FIN4O5/c1-16(2)23(24(33)29-21-8-5-18(28)15-20(21)27)32-25(34)22(30-26(32)35)17-3-6-19(7-4-17)37-14-11-31-9-12-36-13-10-31/h3-8,15-16,22-23H,9-14H2,1-2H3,(H,29,33)(H,30,35) |
| InChIKey | LQKJEAMVAXOVCI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|