C25H26ClN3O5 — CID 89256688
N-(2-chloro-4-ethynylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-methylbutanamide (PubChem CID 89256688) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is N-(2-chloro-4-ethynylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-methylbutanamide.
| Compound Name | N-(2-chloro-4-ethynylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 89256688 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-(2-chloro-4-ethynylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-methylbutanamide |
| SMILES | C#Cc1ccc(NC(=O)C(C(C)C)N2C(=O)N[C@H](c3ccc(OCCOC)cc3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H26ClN3O5/c1-5-16-6-11-20(19(26)14-16)27-23(30)22(15(2)3)29-24(31)21(28-25(29)32)17-7-9-18(10-8-17)34-13-12-33-4/h1,6-11,14-15,21-22H,12-13H2,2-4H3,(H,27,30)(H,28,32)/t21-,22?/m1/s1 |
| InChIKey | VAHWTBITJINPFD-ZMFCMNQTSA-N |
| XLogP | 3.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|