C28H28ClN3O5 — CID 143528439
N-(2-chloro-4-methylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide (PubChem CID 143528439) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 143528439 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[(4R)-4-[4-(2-methoxyethoxy)phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylpropanamide |
| SMILES | COCCOc1ccc([C@H]2NC(=O)N(C(Cc3ccccc3)C(=O)Nc3ccc(C)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C28H28ClN3O5/c1-18-8-13-23(22(29)16-18)30-26(33)24(17-19-6-4-3-5-7-19)32-27(34)25(31-28(32)35)20-9-11-21(12-10-20)37-15-14-36-2/h3-13,16,24-25H,14-15,17H2,1-2H3,(H,30,33)(H,31,35)/t24?,25-/m1/s1 |
| InChIKey | FVBLWDSMLMGXHB-WUBHUQEYSA-N |
| XLogP | 4.52 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|