C15H36N2 — CID 160550613
ethane;methane;2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 160550613) has the molecular formula C15H36N2 and a molecular weight of 244.47 g/mol. Its IUPAC name is ethane;methane;2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | ethane;methane;2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 160550613 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | ethane;methane;2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C.CC.CC.CC(C)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C10H20N2.2C2H6.CH4/c1-9(2)12-7-6-11-5-3-4-10(11)8-12;2*1-2;/h9-10H,3-8H2,1-2H3;2*1-2H3;1H4 |
| InChIKey | QYABXVLHYRYXRD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |