C12H26N2 — CID 161281609
(8aR)-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;ethane (PubChem CID 161281609) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (8aR)-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;ethane.
| Compound Name | (8aR)-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;ethane |
|---|---|
| PubChem CID | 161281609 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (8aR)-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;ethane |
| SMILES | CC.CC(C)N1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C10H20N2.C2H6/c1-9(2)12-7-6-11-5-3-4-10(11)8-12;1-2/h9-10H,3-8H2,1-2H3;1-2H3/t10-;/m1./s1 |
| InChIKey | VFDXTYKCMZRSPL-HNCPQSOCSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |