C29H40N6O2 — CID 160552479
tert-butyl 3-(1H-indazol-6-yl)pyrrolidine-1-carboxylate;deuterioethane;6-pyrrolidin-3-yl-1H-indazole (PubChem CID 160552479) has the molecular formula C29H40N6O2 and a molecular weight of 505.69 g/mol. Its IUPAC name is tert-butyl 3-(1H-indazol-6-yl)pyrrolidine-1-carboxylate;deuterioethane;6-pyrrolidin-3-yl-1H-indazole.
| Compound Name | tert-butyl 3-(1H-indazol-6-yl)pyrrolidine-1-carboxylate;deuterioethane;6-pyrrolidin-3-yl-1H-indazole |
|---|---|
| PubChem CID | 160552479 |
| Molecular Formula | C29H40N6O2 |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | tert-butyl 3-(1H-indazol-6-yl)pyrrolidine-1-carboxylate;deuterioethane;6-pyrrolidin-3-yl-1H-indazole |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc3cn[nH]c3c2)C1.[2H]CC.c1cc2cn[nH]c2cc1C1CCNC1 |
| InChI | InChI=1S/C16H21N3O2.C11H13N3.C2H6/c1-16(2,3)21-15(20)19-7-6-13(10-19)11-4-5-12-9-17-18-14(12)8-11;1-2-10-7-13-14-11(10)5-8(1)9-3-4-12-6-9;1-2/h4-5,8-9,13H,6-7,10H2,1-3H3,(H,17,18);1-2,5,7,9,12H,3-4,6H2,(H,13,14);1-2H3/i;;1D |
| InChIKey | QYGHPBWTOFSJKA-PRQZKWGPSA-N |
| XLogP | 5.95 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |