C27H35NO5 — CID 160555859
N-benzhydryl-2-hydroxy-6-oxo-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]hexanamide (PubChem CID 160555859) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-benzhydryl-2-hydroxy-6-oxo-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]hexanamide.
| Compound Name | N-benzhydryl-2-hydroxy-6-oxo-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]hexanamide |
|---|---|
| PubChem CID | 160555859 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-benzhydryl-2-hydroxy-6-oxo-6-[(4R)-2,2,5,5-tetramethyl-1,3-dioxan-4-yl]hexanamide |
| SMILES | CC1(C)OCC(C)(C)[C@H](C(=O)CCCC(O)C(=O)NC(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C27H35NO5/c1-26(2)18-32-27(3,4)33-24(26)21(29)16-11-17-22(30)25(31)28-23(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-10,12-15,22-24,30H,11,16-18H2,1-4H3,(H,28,31)/t22?,24-/m0/s1 |
| InChIKey | QYRCSDBJCAYGGW-GITCGBDTSA-N |
| XLogP | 4.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |