C23H29ClN6O3 — CID 160556747
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(4-chloro-2-nitrophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 160556747) has the molecular formula C23H29ClN6O3 and a molecular weight of 472.98 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(4-chloro-2-nitrophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(4-chloro-2-nitrophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 160556747 |
| Molecular Formula | C23H29ClN6O3 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(4-chloro-2-nitrophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1cc(CN2CCC(C(=O)N3CCN(Cc4ccc(Cl)cc4[N+](=O)[O-])CC3)CC2)ccn1 |
| InChI | InChI=1S/C23H29ClN6O3/c24-20-2-1-19(21(14-20)30(32)33)16-28-9-11-29(12-10-28)23(31)18-4-7-27(8-5-18)15-17-3-6-26-22(25)13-17/h1-3,6,13-14,18H,4-5,7-12,15-16H2,(H2,25,26) |
| InChIKey | VSNKDOHYOOKWLI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|