C31H68N2 — CID 160559312
1-N,1-N'-ditert-butyldecane-1,1-diamine;2,2-dimethylundecane (PubChem CID 160559312) has the molecular formula C31H68N2 and a molecular weight of 468.90 g/mol. Its IUPAC name is 1-N,1-N'-ditert-butyldecane-1,1-diamine;2,2-dimethylundecane.
| Compound Name | 1-N,1-N'-ditert-butyldecane-1,1-diamine;2,2-dimethylundecane |
|---|---|
| PubChem CID | 160559312 |
| Molecular Formula | C31H68N2 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.54 |
| IUPAC Name | 1-N,1-N'-ditert-butyldecane-1,1-diamine;2,2-dimethylundecane |
| SMILES | CCCCCCCCCC(C)(C)C.CCCCCCCCCC(NC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C18H40N2.C13H28/c1-8-9-10-11-12-13-14-15-16(19-17(2,3)4)20-18(5,6)7;1-5-6-7-8-9-10-11-12-13(2,3)4/h16,19-20H,8-15H2,1-7H3;5-12H2,1-4H3 |
| InChIKey | QZCDLXIDJSPNIN-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|