C15H33N — CID 163425790
(5S)-N-tert-butyl-2,2-dimethylnonan-5-amine (PubChem CID 163425790) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is (5S)-N-tert-butyl-2,2-dimethylnonan-5-amine.
| Compound Name | (5S)-N-tert-butyl-2,2-dimethylnonan-5-amine |
|---|---|
| PubChem CID | 163425790 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | (5S)-N-tert-butyl-2,2-dimethylnonan-5-amine |
| SMILES | CCCC[C@@H](CCC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-8-9-10-13(16-15(5,6)7)11-12-14(2,3)4/h13,16H,8-12H2,1-7H3/t13-/m0/s1 |
| InChIKey | FPFFZEANBJFYOC-ZDUSSCGKSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |