About (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol
(4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol (PubChem CID 162697107) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol.
Molecular Properties
| Compound Name | (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol |
| PubChem CID | 162697107 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol |
| SMILES | CC(C)(C)CC[C@@H](CCCO)NC(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-13(2,3)10-9-12(8-7-11-16)15-14(4,5)6/h12,15-16H,7-11H2,1-6H3/t12-/m1/s1 |
| InChIKey | DQMSNQIXWCLVOP-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol?
The IUPAC name of (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol (CID 162697107) is (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol.
What is the SMILES notation for (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol?
The canonical SMILES for (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol is CC(C)(C)CC[C@@H](CCCO)NC(C)(C)C.
What is the InChIKey of (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol?
The InChIKey is DQMSNQIXWCLVOP-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H31NO/c1-13(2,3)10-9-12(8-7-11-16)15-14(4,5)6/h12,15-16H,7-11H2,1-6H3/t12-/m1/s1.
What are the key properties of (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol?
(4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol has a molecular weight of 229.41 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(tert-butylamino)-7,7-dimethyloctan-1-ol is sourced from PubChem (CID 162697107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).