C36H22N2 — CID 160559545
11-[4-(4-isocyanophenyl)naphthalen-2-yl]-12H-indeno[2,1-a]carbazole (PubChem CID 160559545) has the molecular formula C36H22N2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 11-[4-(4-isocyanophenyl)naphthalen-2-yl]-12H-indeno[2,1-a]carbazole.
| Compound Name | 11-[4-(4-isocyanophenyl)naphthalen-2-yl]-12H-indeno[2,1-a]carbazole |
|---|---|
| PubChem CID | 160559545 |
| Molecular Formula | C36H22N2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 11-[4-(4-isocyanophenyl)naphthalen-2-yl]-12H-indeno[2,1-a]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-n3c4ccccc4c4ccc5c(c43)Cc3ccccc3-5)cc3ccccc23)cc1 |
| InChI | InChI=1S/C36H22N2/c1-37-26-16-14-23(15-17-26)33-22-27(20-24-8-2-5-11-29(24)33)38-35-13-7-6-12-31(35)32-19-18-30-28-10-4-3-9-25(28)21-34(30)36(32)38/h2-20,22H,21H2 |
| InChIKey | SBIFQTUOMVJLFD-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|