C28H38BrNO6 — CID 160562712
acetonitrile;2-bromo-1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone;1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone (PubChem CID 160562712) has the molecular formula C28H38BrNO6 and a molecular weight of 564.52 g/mol. Its IUPAC name is acetonitrile;2-bromo-1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone;1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone.
| Compound Name | acetonitrile;2-bromo-1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone;1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 160562712 |
| Molecular Formula | C28H38BrNO6 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | acetonitrile;2-bromo-1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone;1-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]ethanone |
| SMILES | CC#N.COCCOc1cc(C)c(C(=O)CBr)c(C)c1.COCCOc1cc(C)c(C(C)=O)c(C)c1 |
| InChI | InChI=1S/C13H17BrO3.C13H18O3.C2H3N/c1-9-6-11(17-5-4-16-3)7-10(2)13(9)12(15)8-14;1-9-7-12(16-6-5-15-4)8-10(2)13(9)11(3)14;1-2-3/h6-7H,4-5,8H2,1-3H3;7-8H,5-6H2,1-4H3;1H3 |
| InChIKey | QZNHTZGTPNZKMY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|