C14H19BrO4 — CID 163445811
2-bromo-1-[4-(2-hydroxy-3-methoxypropoxy)-2,6-dimethylphenyl]ethanone (PubChem CID 163445811) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-bromo-1-[4-(2-hydroxy-3-methoxypropoxy)-2,6-dimethylphenyl]ethanone.
| Compound Name | 2-bromo-1-[4-(2-hydroxy-3-methoxypropoxy)-2,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 163445811 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-bromo-1-[4-(2-hydroxy-3-methoxypropoxy)-2,6-dimethylphenyl]ethanone |
| SMILES | COCC(O)COc1cc(C)c(C(=O)CBr)c(C)c1 |
| InChI | InChI=1S/C14H19BrO4/c1-9-4-12(19-8-11(16)7-18-3)5-10(2)14(9)13(17)6-15/h4-5,11,16H,6-8H2,1-3H3 |
| InChIKey | BCKGBXLJRXSHQF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|