C36H41N3O4 — CID 160565573
tert-butyl N-[2-[2-[1-(2-morpholin-4-ylethyl)-3-prop-2-enylindol-5-yl]-2-oxoethyl]-4-phenylphenyl]carbamate (PubChem CID 160565573) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[1-(2-morpholin-4-ylethyl)-3-prop-2-enylindol-5-yl]-2-oxoethyl]-4-phenylphenyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[1-(2-morpholin-4-ylethyl)-3-prop-2-enylindol-5-yl]-2-oxoethyl]-4-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 160565573 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | tert-butyl N-[2-[2-[1-(2-morpholin-4-ylethyl)-3-prop-2-enylindol-5-yl]-2-oxoethyl]-4-phenylphenyl]carbamate |
| SMILES | C=CCc1cn(CCN2CCOCC2)c2ccc(C(=O)Cc3cc(-c4ccccc4)ccc3NC(=O)OC(C)(C)C)cc12 |
| InChI | InChI=1S/C36H41N3O4/c1-5-9-29-25-39(17-16-38-18-20-42-21-19-38)33-15-13-28(23-31(29)33)34(40)24-30-22-27(26-10-7-6-8-11-26)12-14-32(30)37-35(41)43-36(2,3)4/h5-8,10-15,22-23,25H,1,9,16-21,24H2,2-4H3,(H,37,41) |
| InChIKey | NVFLEANTAXPAGX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|