dodecyl(dimethyl)azanium fluoride

C14H32FN — CID 160570915

IUPACdodecyl(dimethyl)azanium fluoride
SMILESCCCCCCCCCCCC[NH+](C)C.[F-]
InChIInChI=1S/C14H31N.FH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H
InChIKeyRANPOHRWZYZACF-UHFFFAOYSA-N
MW233.41 g/mol
LogP0.06
Rot. Bonds11

About dodecyl(dimethyl)azanium fluoride

dodecyl(dimethyl)azanium fluoride (PubChem CID 160570915) has the molecular formula C14H32FN and a molecular weight of 233.41 g/mol. Its IUPAC name is dodecyl(dimethyl)azanium fluoride.

Molecular Properties

Compound Namedodecyl(dimethyl)azanium fluoride
PubChem CID160570915
Molecular FormulaC14H32FN
Molecular Weight233.41 g/mol
Exact Mass233.25
IUPAC Namedodecyl(dimethyl)azanium fluoride
SMILESCCCCCCCCCCCC[NH+](C)C.[F-]
InChIInChI=1S/C14H31N.FH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H
InChIKeyRANPOHRWZYZACF-UHFFFAOYSA-N
XLogP0.06
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds11
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.41
LogP ≤ 50.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze dodecyl(dimethyl)azanium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dodecyl(dimethyl)azanium fluoride?
The IUPAC name of dodecyl(dimethyl)azanium fluoride (CID 160570915) is dodecyl(dimethyl)azanium fluoride.
What is the SMILES notation for dodecyl(dimethyl)azanium fluoride?
The canonical SMILES for dodecyl(dimethyl)azanium fluoride is CCCCCCCCCCCC[NH+](C)C.[F-].
What is the InChIKey of dodecyl(dimethyl)azanium fluoride?
The InChIKey is RANPOHRWZYZACF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.FH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H.
What are the key properties of dodecyl(dimethyl)azanium fluoride?
dodecyl(dimethyl)azanium fluoride has a molecular weight of 233.41 g/mol, XLogP of 0.06, 11 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl(dimethyl)azanium fluoride is sourced from PubChem (CID 160570915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).