About dodecyl(dimethyl)azanium fluoride
dodecyl(dimethyl)azanium fluoride (PubChem CID 160570915) has the molecular formula C14H32FN
and a molecular weight of 233.41 g/mol. Its IUPAC name is dodecyl(dimethyl)azanium fluoride.
Molecular Properties
| Compound Name | dodecyl(dimethyl)azanium fluoride |
| PubChem CID | 160570915 |
| Molecular Formula | C14H32FN |
| Molecular Weight | 233.41 g/mol |
| Exact Mass | 233.25 |
| IUPAC Name | dodecyl(dimethyl)azanium fluoride |
| SMILES | CCCCCCCCCCCC[NH+](C)C.[F-] |
| InChI | InChI=1S/C14H31N.FH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H |
| InChIKey | RANPOHRWZYZACF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecyl(dimethyl)azanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl(dimethyl)azanium fluoride?
The IUPAC name of dodecyl(dimethyl)azanium fluoride (CID 160570915) is dodecyl(dimethyl)azanium fluoride.
What is the SMILES notation for dodecyl(dimethyl)azanium fluoride?
The canonical SMILES for dodecyl(dimethyl)azanium fluoride is CCCCCCCCCCCC[NH+](C)C.[F-].
What is the InChIKey of dodecyl(dimethyl)azanium fluoride?
The InChIKey is RANPOHRWZYZACF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.FH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H.
What are the key properties of dodecyl(dimethyl)azanium fluoride?
dodecyl(dimethyl)azanium fluoride has a molecular weight of 233.41 g/mol, XLogP of 0.06, 11 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl(dimethyl)azanium fluoride is sourced from PubChem (CID 160570915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).