C25H28N2O3 — CID 160571581
3-benzyl-2-[3-(2-methoxyethoxy)-4-pyridinyl]-6,6-dimethyl-5,7-dihydro-1H-indol-4-one (PubChem CID 160571581) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-benzyl-2-[3-(2-methoxyethoxy)-4-pyridinyl]-6,6-dimethyl-5,7-dihydro-1H-indol-4-one.
| Compound Name | 3-benzyl-2-[3-(2-methoxyethoxy)-4-pyridinyl]-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
|---|---|
| PubChem CID | 160571581 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-benzyl-2-[3-(2-methoxyethoxy)-4-pyridinyl]-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
| SMILES | COCCOc1cnccc1-c1[nH]c2c(c1Cc1ccccc1)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H28N2O3/c1-25(2)14-20-23(21(28)15-25)19(13-17-7-5-4-6-8-17)24(27-20)18-9-10-26-16-22(18)30-12-11-29-3/h4-10,16,27H,11-15H2,1-3H3 |
| InChIKey | RAPSEPBURAAYPQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|