C22H23N3O — CID 159242491
2-(2-amino-4-pyridinyl)-3-benzyl-6,6-dimethyl-5,7-dihydro-1H-indol-4-one (PubChem CID 159242491) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-3-benzyl-6,6-dimethyl-5,7-dihydro-1H-indol-4-one.
| Compound Name | 2-(2-amino-4-pyridinyl)-3-benzyl-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
|---|---|
| PubChem CID | 159242491 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-3-benzyl-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
| SMILES | CC1(C)CC(=O)c2c([nH]c(-c3ccnc(N)c3)c2Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H23N3O/c1-22(2)12-17-20(18(26)13-22)16(10-14-6-4-3-5-7-14)21(25-17)15-8-9-24-19(23)11-15/h3-9,11,25H,10,12-13H2,1-2H3,(H2,23,24) |
| InChIKey | KUGOSZHYSIYILS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |