C38H41N3O2Si — CID 152882144
2-(2-amino-4-pyridinyl)-3-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-5,7-dihydro-1H-indol-4-one (PubChem CID 152882144) has the molecular formula C38H41N3O2Si and a molecular weight of 599.85 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-3-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-5,7-dihydro-1H-indol-4-one.
| Compound Name | 2-(2-amino-4-pyridinyl)-3-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-5,7-dihydro-1H-indol-4-one |
|---|---|
| PubChem CID | 152882144 |
| Molecular Formula | C38H41N3O2Si |
| Molecular Weight | 599.85 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-3-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methyl-5,7-dihydro-1H-indol-4-one |
| SMILES | CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)c2c([nH]c(-c3ccnc(N)c3)c2Cc2ccccc2)C1 |
| InChI | InChI=1S/C38H41N3O2Si/c1-37(2,3)44(29-16-10-6-11-17-29,30-18-12-7-13-19-30)43-26-38(4)24-32-35(33(42)25-38)31(22-27-14-8-5-9-15-27)36(41-32)28-20-21-40-34(39)23-28/h5-21,23,41H,22,24-26H2,1-4H3,(H2,39,40) |
| InChIKey | UBRMIBKFSBOXMF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.85 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|