C13H20N2O — CID 160572472
2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-diazinane (PubChem CID 160572472) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-diazinane.
| Compound Name | 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-diazinane |
|---|---|
| PubChem CID | 160572472 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-diazinane |
| SMILES | COc1ccc(C2NCC(C)CN2)cc1C |
| InChI | InChI=1S/C13H20N2O/c1-9-7-14-13(15-8-9)11-4-5-12(16-3)10(2)6-11/h4-6,9,13-15H,7-8H2,1-3H3 |
| InChIKey | RASNNYRFUVSALX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |