C12H17NOS — CID 66241618
2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazolidine (PubChem CID 66241618) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 66241618 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-5-methyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2NCC(C)S2)cc1C |
| InChI | InChI=1S/C12H17NOS/c1-8-6-10(4-5-11(8)14-3)12-13-7-9(2)15-12/h4-6,9,12-13H,7H2,1-3H3 |
| InChIKey | IISXVANDFGPMGN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |