C11H15NO2S — CID 66218899
2-methoxy-5-(4-methyl-1,3-thiazolidin-2-yl)phenol (PubChem CID 66218899) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2-methoxy-5-(4-methyl-1,3-thiazolidin-2-yl)phenol.
| Compound Name | 2-methoxy-5-(4-methyl-1,3-thiazolidin-2-yl)phenol |
|---|---|
| PubChem CID | 66218899 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-methoxy-5-(4-methyl-1,3-thiazolidin-2-yl)phenol |
| SMILES | COc1ccc(C2NC(C)CS2)cc1O |
| InChI | InChI=1S/C11H15NO2S/c1-7-6-15-11(12-7)8-3-4-10(14-2)9(13)5-8/h3-5,7,11-13H,6H2,1-2H3 |
| InChIKey | OERUMRIAVQWVNR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |