C12H17NO2S — CID 66224901
2-methoxy-5-(6-methyl-1,3-thiazinan-2-yl)phenol (PubChem CID 66224901) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-methoxy-5-(6-methyl-1,3-thiazinan-2-yl)phenol.
| Compound Name | 2-methoxy-5-(6-methyl-1,3-thiazinan-2-yl)phenol |
|---|---|
| PubChem CID | 66224901 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-methoxy-5-(6-methyl-1,3-thiazinan-2-yl)phenol |
| SMILES | COc1ccc(C2NCCC(C)S2)cc1O |
| InChI | InChI=1S/C12H17NO2S/c1-8-5-6-13-12(16-8)9-3-4-11(15-2)10(14)7-9/h3-4,7-8,12-14H,5-6H2,1-2H3 |
| InChIKey | CZKNVNXENQXNPG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |