C11H14BrNS — CID 66224229
2-(4-bromophenyl)-6-methyl-1,3-thiazinane (PubChem CID 66224229) has the molecular formula C11H14BrNS and a molecular weight of 272.21 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-methyl-1,3-thiazinane.
| Compound Name | 2-(4-bromophenyl)-6-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 66224229 |
| Molecular Formula | C11H14BrNS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-(4-bromophenyl)-6-methyl-1,3-thiazinane |
| SMILES | CC1CCNC(c2ccc(Br)cc2)S1 |
| InChI | InChI=1S/C11H14BrNS/c1-8-6-7-13-11(14-8)9-2-4-10(12)5-3-9/h2-5,8,11,13H,6-7H2,1H3 |
| InChIKey | HFRDLWCZERMDSK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |