C14H15BrN2S — CID 112618396
2-(5-bromoquinolin-8-yl)-6-methyl-1,3-thiazinane (PubChem CID 112618396) has the molecular formula C14H15BrN2S and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-(5-bromoquinolin-8-yl)-6-methyl-1,3-thiazinane.
| Compound Name | 2-(5-bromoquinolin-8-yl)-6-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 112618396 |
| Molecular Formula | C14H15BrN2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-(5-bromoquinolin-8-yl)-6-methyl-1,3-thiazinane |
| SMILES | CC1CCNC(c2ccc(Br)c3cccnc23)S1 |
| InChI | InChI=1S/C14H15BrN2S/c1-9-6-8-17-14(18-9)11-4-5-12(15)10-3-2-7-16-13(10)11/h2-5,7,9,14,17H,6,8H2,1H3 |
| InChIKey | NWGMPADIFBYIFM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |