C48H55N5O2 — CID 160574392
4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;4-[3-(2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;methane (PubChem CID 160574392) has the molecular formula C48H55N5O2 and a molecular weight of 734.00 g/mol. Its IUPAC name is 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;4-[3-(2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;methane.
| Compound Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;4-[3-(2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;methane |
|---|---|
| PubChem CID | 160574392 |
| Molecular Formula | C48H55N5O2 |
| Molecular Weight | 734.00 g/mol |
| Exact Mass | 733.44 |
| IUPAC Name | 4-[3-(3-amino-2-methylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;4-[3-(2,3-dimethylphenyl)-5-isocyano-6-methylindol-1-yl]cyclohexan-1-ol;methane |
| SMILES | C.[C-]#[N+]c1cc2c(-c3cccc(C)c3C)cn(C3CCC(O)CC3)c2cc1C.[C-]#[N+]c1cc2c(-c3cccc(N)c3C)cn(C3CCC(O)CC3)c2cc1C |
| InChI | InChI=1S/C24H26N2O.C23H25N3O.CH4/c1-15-6-5-7-20(17(15)3)22-14-26(18-8-10-19(27)11-9-18)24-12-16(2)23(25-4)13-21(22)24;1-14-11-23-19(12-22(14)25-3)20(18-5-4-6-21(24)15(18)2)13-26(23)16-7-9-17(27)10-8-16;/h5-7,12-14,18-19,27H,8-11H2,1-3H3;4-6,11-13,16-17,27H,7-10,24H2,1-2H3;1H4 |
| InChIKey | RAYNZEDLOOKBGI-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.00 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|