About pentafluoro-λ5-arsane;sulfurofluoridic acid
pentafluoro-λ5-arsane;sulfurofluoridic acid (PubChem CID 160575370) has the molecular formula HAsF6O3S
and a molecular weight of 269.98 g/mol. Its IUPAC name is pentafluoro-λ5-arsane;sulfurofluoridic acid.
Molecular Properties
| Compound Name | pentafluoro-λ5-arsane;sulfurofluoridic acid |
| PubChem CID | 160575370 |
| Molecular Formula | HAsF6O3S |
| Molecular Weight | 269.98 g/mol |
| Exact Mass | 269.88 |
| IUPAC Name | pentafluoro-λ5-arsane;sulfurofluoridic acid |
| SMILES | F[As](F)(F)(F)F.O=S(=O)(O)F |
| InChI | InChI=1S/AsF5.FHO3S/c2-1(3,4,5)6;1-5(2,3)4/h;(H,2,3,4) |
| InChIKey | RBBPYCRTANJIQI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.98 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pentafluoro-λ5-arsane;sulfurofluoridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro-λ5-arsane;sulfurofluoridic acid?
The IUPAC name of pentafluoro-λ5-arsane;sulfurofluoridic acid (CID 160575370) is pentafluoro-λ5-arsane;sulfurofluoridic acid.
What is the SMILES notation for pentafluoro-λ5-arsane;sulfurofluoridic acid?
The canonical SMILES for pentafluoro-λ5-arsane;sulfurofluoridic acid is F[As](F)(F)(F)F.O=S(=O)(O)F.
What is the InChIKey of pentafluoro-λ5-arsane;sulfurofluoridic acid?
The InChIKey is RBBPYCRTANJIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/AsF5.FHO3S/c2-1(3,4,5)6;1-5(2,3)4/h;(H,2,3,4).
What are the key properties of pentafluoro-λ5-arsane;sulfurofluoridic acid?
pentafluoro-λ5-arsane;sulfurofluoridic acid has a molecular weight of 269.98 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro-λ5-arsane;sulfurofluoridic acid is sourced from PubChem (CID 160575370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).