C21H22F2N4O4S — CID 160577285
CID 160577285 (PubChem CID 160577285) has the molecular formula C21H22F2N4O4S and a molecular weight of 464.49 g/mol.
| Compound Name | CID 160577285 |
|---|---|
| PubChem CID | 160577285 |
| Molecular Formula | C21H22F2N4O4S |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | — |
| SMILES | CCc1ncc(Oc2ccc(F)cc2F)c(-c2cc(C)c(=O)n(C(C)C)c2)n1.N=S(=O)=O |
| InChI | InChI=1S/C21H21F2N3O2.HNO2S/c1-5-19-24-10-18(28-17-7-6-15(22)9-16(17)23)20(25-19)14-8-13(4)21(27)26(11-14)12(2)3;1-4(2)3/h6-12H,5H2,1-4H3;1H |
| InChIKey | RBHXCKPVIXMCDJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |