C36H30N4O5 — CID 160580543
4-[3-(4-aminophenoxy)-4-[2,4-bis(4-aminophenoxy)phenoxy]phenoxy]aniline (PubChem CID 160580543) has the molecular formula C36H30N4O5 and a molecular weight of 598.66 g/mol. Its IUPAC name is 4-[3-(4-aminophenoxy)-4-[2,4-bis(4-aminophenoxy)phenoxy]phenoxy]aniline.
| Compound Name | 4-[3-(4-aminophenoxy)-4-[2,4-bis(4-aminophenoxy)phenoxy]phenoxy]aniline |
|---|---|
| PubChem CID | 160580543 |
| Molecular Formula | C36H30N4O5 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 4-[3-(4-aminophenoxy)-4-[2,4-bis(4-aminophenoxy)phenoxy]phenoxy]aniline |
| SMILES | Nc1ccc(Oc2ccc(Oc3ccc(Oc4ccc(N)cc4)cc3Oc3ccc(N)cc3)c(Oc3ccc(N)cc3)c2)cc1 |
| InChI | InChI=1S/C36H30N4O5/c37-23-1-9-27(10-2-23)41-31-17-19-33(35(21-31)43-29-13-5-25(39)6-14-29)45-34-20-18-32(42-28-11-3-24(38)4-12-28)22-36(34)44-30-15-7-26(40)8-16-30/h1-22H,37-40H2 |
| InChIKey | RBSLBHFQQNWDIL-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|