C14H22N2O3S — CID 160584116
(S)-N-[(1R)-1-(2,3-dimethyl-5-nitrophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 160584116) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is (S)-N-[(1R)-1-(2,3-dimethyl-5-nitrophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-(2,3-dimethyl-5-nitrophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 160584116 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (S)-N-[(1R)-1-(2,3-dimethyl-5-nitrophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cc([N+](=O)[O-])cc([C@@H](C)N[S@@](=O)C(C)(C)C)c1C |
| InChI | InChI=1S/C14H22N2O3S/c1-9-7-12(16(17)18)8-13(10(9)2)11(3)15-20(19)14(4,5)6/h7-8,11,15H,1-6H3/t11-,20+/m1/s1 |
| InChIKey | RCDWWMVRBGJFRA-GIPWTMENSA-N |
| XLogP | 3.32 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|