C26H37BN2O5S — CID 160585104
tert-butyl (1R,3S,4S)-3-[(3S)-3-cyano-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 160585104) has the molecular formula C26H37BN2O5S and a molecular weight of 500.47 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[(3S)-3-cyano-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[(3S)-3-cyano-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 160585104 |
| Molecular Formula | C26H37BN2O5S |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[(3S)-3-cyano-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)C[C@H](C#N)Cc1ccc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C26H37BN2O5S/c1-24(2,3)32-23(31)29-18-9-8-17(14-18)22(29)20(30)13-16(15-28)12-19-10-11-21(35-19)27-33-25(4,5)26(6,7)34-27/h10-11,16-18,22H,8-9,12-14H2,1-7H3/t16-,17+,18-,22+/m1/s1 |
| InChIKey | ZMDWDLGTVJKQHJ-FOUBCARRSA-N |
| XLogP | 4.48 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|