C28H40BN3O6 — CID 90430836
tert-butyl (1R,3S,4S)-3-[[1-cyano-2-[3-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 90430836) has the molecular formula C28H40BN3O6 and a molecular weight of 525.46 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[[1-cyano-2-[3-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[[1-cyano-2-[3-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90430836 |
| Molecular Formula | C28H40BN3O6 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[[1-cyano-2-[3-(hydroxymethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)NC(C#N)Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(CO)c1 |
| InChI | InChI=1S/C28H40BN3O6/c1-26(2,3)36-25(35)32-21-10-9-18(14-21)23(32)24(34)31-20(15-30)13-17-8-11-22(19(12-17)16-33)29-37-27(4,5)28(6,7)38-29/h8,11-12,18,20-21,23,33H,9-10,13-14,16H2,1-7H3,(H,31,34)/t18-,20?,21+,23-/m0/s1 |
| InChIKey | RJHYFEDAZKWJNF-SEKSNCCNSA-N |
| XLogP | 2.82 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|