C32H38N4O4 — CID 89471784
tert-butyl (1R,3S,4S)-3-[[(1S)-1-cyano-2-[4-(1,3,3-trimethyl-2-oxoindol-6-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 89471784) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[[(1S)-1-cyano-2-[4-(1,3,3-trimethyl-2-oxoindol-6-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[[(1S)-1-cyano-2-[4-(1,3,3-trimethyl-2-oxoindol-6-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89471784 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[[(1S)-1-cyano-2-[4-(1,3,3-trimethyl-2-oxoindol-6-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CN1C(=O)C(C)(C)c2ccc(-c3ccc(C[C@@H](C#N)NC(=O)[C@@H]4[C@H]5CC[C@H](C5)N4C(=O)OC(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C32H38N4O4/c1-31(2,3)40-30(39)36-24-13-11-22(16-24)27(36)28(37)34-23(18-33)15-19-7-9-20(10-8-19)21-12-14-25-26(17-21)35(6)29(38)32(25,4)5/h7-10,12,14,17,22-24,27H,11,13,15-16H2,1-6H3,(H,34,37)/t22-,23-,24+,27-/m0/s1 |
| InChIKey | AWUYXHKAYVKZJO-LUFNOOMBSA-N |
| XLogP | 4.95 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |