C26H32N2O6 — CID 160585494
(2R)-2-aminopropanoic acid;5-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-aminopent-2-enedioate (PubChem CID 160585494) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is (2R)-2-aminopropanoic acid;5-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-aminopent-2-enedioate.
| Compound Name | (2R)-2-aminopropanoic acid;5-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-aminopent-2-enedioate |
|---|---|
| PubChem CID | 160585494 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (2R)-2-aminopropanoic acid;5-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-aminopent-2-enedioate |
| SMILES | CC(C)(C)OC(=O)CC=C(N)C(=O)OCC1c2ccccc2-c2ccccc21.C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C23H25NO4.C3H7NO2/c1-23(2,3)28-21(25)13-12-20(24)22(26)27-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19;1-2(4)3(5)6/h4-12,19H,13-14,24H2,1-3H3;2H,4H2,1H3,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | RCILIJMHDVFNSP-ARGLLVQISA-N |
| XLogP | 3.33 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|