C34H38N4O6 — CID 160586338
tert-butyl 3-amino-5-(2-methyl-4-pyridinyl)benzoate;tert-butyl 3-(2-methyl-4-pyridinyl)-5-nitrobenzoate (PubChem CID 160586338) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is tert-butyl 3-amino-5-(2-methyl-4-pyridinyl)benzoate;tert-butyl 3-(2-methyl-4-pyridinyl)-5-nitrobenzoate.
| Compound Name | tert-butyl 3-amino-5-(2-methyl-4-pyridinyl)benzoate;tert-butyl 3-(2-methyl-4-pyridinyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 160586338 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | tert-butyl 3-amino-5-(2-methyl-4-pyridinyl)benzoate;tert-butyl 3-(2-methyl-4-pyridinyl)-5-nitrobenzoate |
| SMILES | Cc1cc(-c2cc(C(=O)OC(C)(C)C)cc([N+](=O)[O-])c2)ccn1.Cc1cc(-c2cc(N)cc(C(=O)OC(C)(C)C)c2)ccn1 |
| InChI | InChI=1S/C17H18N2O4.C17H20N2O2/c1-11-7-12(5-6-18-11)13-8-14(10-15(9-13)19(21)22)16(20)23-17(2,3)4;1-11-7-12(5-6-19-11)13-8-14(10-15(18)9-13)16(20)21-17(2,3)4/h5-10H,1-4H3;5-10H,18H2,1-4H3 |
| InChIKey | RCLBDGFXQDDNGH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|