About (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid
(1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid (PubChem CID 160586980) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid.
Analyze (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid?
The IUPAC name of (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid (CID 160586980) is (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid.
What is the SMILES notation for (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid?
The canonical SMILES for (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid is CC1N=C(NC(=O)O)N(C)C(=O)C1C.
What is the InChIKey of (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid?
The InChIKey is RCNCQPXFLHZWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-4-5(2)9-7(10-8(13)14)11(3)6(4)12/h4-5H,1-3H3,(H,9,10)(H,13,14).
What are the key properties of (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid?
(1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid has a molecular weight of 199.21 g/mol, XLogP of 0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4,5-trimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamic acid is sourced from PubChem (CID 160586980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).