C7H10N3O3- — CID 131731836
N-(1,4-dimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamate (PubChem CID 131731836) has the molecular formula C7H10N3O3- and a molecular weight of 184.17 g/mol. Its IUPAC name is N-(1,4-dimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamate.
| Compound Name | N-(1,4-dimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamate |
|---|---|
| PubChem CID | 131731836 |
| Molecular Formula | C7H10N3O3- |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-(1,4-dimethyl-6-oxo-4,5-dihydropyrimidin-2-yl)carbamate |
| SMILES | CC1CC(=O)N(C)C(NC(=O)[O-])=N1 |
| InChI | InChI=1S/C7H11N3O3/c1-4-3-5(11)10(2)6(8-4)9-7(12)13/h4H,3H2,1-2H3,(H,8,9)(H,12,13)/p-1 |
| InChIKey | AXONEFXRIBFKHW-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |