C6H11N3O — CID 70142751
(4S)-2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one (PubChem CID 70142751) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is (4S)-2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one.
| Compound Name | (4S)-2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 70142751 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | (4S)-2-amino-1,4-dimethyl-4,5-dihydropyrimidin-6-one |
| SMILES | C[C@H]1CC(=O)N(C)C(N)=N1 |
| InChI | InChI=1S/C6H11N3O/c1-4-3-5(10)9(2)6(7)8-4/h4H,3H2,1-2H3,(H2,7,8)/t4-/m0/s1 |
| InChIKey | JCWRWGJUSXXVSO-BYPYZUCNSA-N |
| XLogP | -0.45 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |