C31H46N10O7S3 — CID 160588187
bis(4-(6,7-dimethylquinazolin-4-yl)-1,4-diazepane-1-sulfonamide);methanesulfonic acid (PubChem CID 160588187) has the molecular formula C31H46N10O7S3 and a molecular weight of 766.97 g/mol. Its IUPAC name is bis(4-(6,7-dimethylquinazolin-4-yl)-1,4-diazepane-1-sulfonamide);methanesulfonic acid.
| Compound Name | bis(4-(6,7-dimethylquinazolin-4-yl)-1,4-diazepane-1-sulfonamide);methanesulfonic acid |
|---|---|
| PubChem CID | 160588187 |
| Molecular Formula | C31H46N10O7S3 |
| Molecular Weight | 766.97 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | bis(4-(6,7-dimethylquinazolin-4-yl)-1,4-diazepane-1-sulfonamide);methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1cc2ncnc(N3CCCN(S(N)(=O)=O)CC3)c2cc1C.Cc1cc2ncnc(N3CCCN(S(N)(=O)=O)CC3)c2cc1C |
| InChI | InChI=1S/2C15H21N5O2S.CH4O3S/c2*1-11-8-13-14(9-12(11)2)17-10-18-15(13)19-4-3-5-20(7-6-19)23(16,21)22;1-5(2,3)4/h2*8-10H,3-7H2,1-2H3,(H2,16,21,22);1H3,(H,2,3,4) |
| InChIKey | BFEHJYHDPIQSNF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 239.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.97 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|