C45H50N10 — CID 160592420
1,5-dimethylindazole;1,6-dimethylindazole;1,7-dimethylindazole;3,4-dimethyl-2H-indazole;6,7-dimethyl-1H-indazole (PubChem CID 160592420) has the molecular formula C45H50N10 and a molecular weight of 730.97 g/mol. Its IUPAC name is 1,5-dimethylindazole;1,6-dimethylindazole;1,7-dimethylindazole;3,4-dimethyl-2H-indazole;6,7-dimethyl-1H-indazole.
| Compound Name | 1,5-dimethylindazole;1,6-dimethylindazole;1,7-dimethylindazole;3,4-dimethyl-2H-indazole;6,7-dimethyl-1H-indazole |
|---|---|
| PubChem CID | 160592420 |
| Molecular Formula | C45H50N10 |
| Molecular Weight | 730.97 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | 1,5-dimethylindazole;1,6-dimethylindazole;1,7-dimethylindazole;3,4-dimethyl-2H-indazole;6,7-dimethyl-1H-indazole |
| SMILES | Cc1ccc2c(cnn2C)c1.Cc1ccc2cn[nH]c2c1C.Cc1ccc2cnn(C)c2c1.Cc1cccc2cnn(C)c12.Cc1cccc2n[nH]c(C)c12 |
| InChI | InChI=1S/5C9H10N2/c1-7-3-4-9-8(5-7)6-10-11(9)2;1-7-3-4-8-6-10-11(2)9(8)5-7;1-6-3-4-8-5-10-11-9(8)7(6)2;1-7-4-3-5-8-6-10-11(2)9(7)8;1-6-4-3-5-8-9(6)7(2)10-11-8/h2*3-6H,1-2H3;3-5H,1-2H3,(H,10,11);3-6H,1-2H3;3-5H,1-2H3,(H,10,11) |
| InChIKey | RDEXVVPBGACKNG-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.97 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |