C28H48O9 — CID 160594356
2-[1,3-bis(prop-2-enoxy)propan-2-yloxy]oxane;2-[1-(oxiran-2-ylmethoxy)-3-prop-2-enoxypropan-2-yl]oxyoxane (PubChem CID 160594356) has the molecular formula C28H48O9 and a molecular weight of 528.68 g/mol. Its IUPAC name is 2-[1,3-bis(prop-2-enoxy)propan-2-yloxy]oxane;2-[1-(oxiran-2-ylmethoxy)-3-prop-2-enoxypropan-2-yl]oxyoxane.
| Compound Name | 2-[1,3-bis(prop-2-enoxy)propan-2-yloxy]oxane;2-[1-(oxiran-2-ylmethoxy)-3-prop-2-enoxypropan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 160594356 |
| Molecular Formula | C28H48O9 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 2-[1,3-bis(prop-2-enoxy)propan-2-yloxy]oxane;2-[1-(oxiran-2-ylmethoxy)-3-prop-2-enoxypropan-2-yl]oxyoxane |
| SMILES | C=CCOCC(COCC1CO1)OC1CCCCO1.C=CCOCC(COCC=C)OC1CCCCO1 |
| InChI | InChI=1S/C14H24O5.C14H24O4/c1-2-6-15-9-13(10-16-8-12-11-18-12)19-14-5-3-4-7-17-14;1-3-8-15-11-13(12-16-9-4-2)18-14-7-5-6-10-17-14/h2,12-14H,1,3-11H2;3-4,13-14H,1-2,5-12H2 |
| InChIKey | RDKYSEHPALBLKD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|